On Target MIF_HUMAN 0.26422763/CHEMBL1253380
For the given ligand test molecule, we have found in our database that, being scored 0.26422763, the most similar ligand is CHEMBL1253380. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL1253380 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | O=C(Oc1ccc(-c2ccccc2)nn1)c1cccs1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 04012044 04000818 a0000108 20210200 01081040 00004182 004c0080 00880000 00000300 00002840 00000200 60008080 0080c016 00010200 01812000 061c201c 09238000 0280080c 04600000 00a20212 00042020 4c000a80 30908800 10c05004 02104800 84002040 10020000 80000064 00004204 00420000 c0000200 10c10000 |