On Target 5HT2B_HUMAN 0.35793358/CHEMBL1836317
For the given ligand test molecule, we have found in our database that, being scored 0.35793358, the most similar ligand is CHEMBL1836317. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL1836317 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | CS(=O)(=O)NC[C@H]1CC[C@H](Nc2nc3c(s2)CCSc2ccccc2-3)CC1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 04030002 01800201 80120980 01310614 01000060 40000020 40402180 103a8088 00400000 214948c2 00602a00 7001a400 06018008 00340001 a2422841 0014c004 0c022400 22206080 26002018 c0a04011 c0000800 180820b0 60804800 14514019 22843080 8c100004 20200000 1400047c 0402401e 040e2020 1006d804 05250270 |