On Target NMDE1_HUMAN 0.25270757/CHEMBL4555447
For the given ligand test molecule, we have found in our database that, being scored 0.25270757, the most similar ligand is CHEMBL4555447. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL4555447 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | Cc1ncc(CNNC(=O)c2cnc(CNS(=O)(=O)c3ccc(F)c(F)c3)c(C)n2)s1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00020016 08c08000 01180804 13b01618 040c0040 000a0012 1400c881 00019809 10000080 41003858 41b92a00 70008000 00008010 08301021 b0a22488 00040204 09003000 02000080 07400011 80006400 a0001080 08089680 61004000 18410108 22140000 0e000006 88000010 0000180d 08040404 204e9803 80000000 80050260 |