On Target IKKB_HUMAN 0.3602941/CHEMBL1986263
For the given ligand test molecule, we have found in our database that, being scored 0.3602941, the most similar ligand is CHEMBL1986263. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL1986263 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | CCn1c(C)c(-c2ccnc(Nc3cccc(OC)c3)n2)sc1=O |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00030042 a0010819 20100909 01240610 21101004 00016000 824028a0 18108008 05000500 080008e1 00208a04 70028a10 03008002 08710001 81022147 800c840c 020e0020 92006080 08400010 90a22400 40800001 9d0a2080 24e02940 18210510 020c1103 4c080000 05200a06 104102e4 0010821c 04460800 60000000 208300b2 |