On Target MK03_HUMAN 0.38019168/CHEMBL4216900
For the given ligand test molecule, we have found in our database that, being scored 0.38019168, the most similar ligand is CHEMBL4216900. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL4216900 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | CCNc1ncc(-c2ccc(C3=CCN(C(=O)CN4CC[C@@](SC)(C(=O)Nc5ccc6[nH]nc(-c7ccnc(C)c7)c6c5)C4)CC3)cc2)s1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00036052 08009e08 a0104180 1c110650 21050020 0000201a c2580180 38128408 00200900 225c4deb 08388a04 7002be00 8e418912 0055a001 80022843 820c200c 24260400 020051c8 4c600012 90a21605 61100100 3e0e8688 70a0aa01 16614018 02141001 8c080000 104a6240 500107e5 0840c00c 000e247b 0c005400 07a14620 |