On Target NMDZ1_HUMAN 0.17486338/CHEMBL325890
For the given ligand Sal-EOM, we have found in our database that, being scored 0.17486338, the most similar ligand is CHEMBL325890. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL325890 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | Oc1nc2ccc(C#CCN3CCC(Cc4ccccc4)CC3)cc2o1 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 00000202 01020010 001a0902 04090600 00442210 00000000 00000404 20100220 001a4c20 000808d0 0c300105 5001a002 40000402 01600000 20100140 0604000c 04000000 42000004 02200080 40000201 40020100 18900000 20890001 06d80010 00000004 80000000 00000210 18000000 00402000 01060002 00140020 04000600 |