On Target PDE5A_HUMAN 0.25306123/CHEMBL497293
For the given ligand Sal-EOM, we have found in our database that, being scored 0.25306123, the most similar ligand is CHEMBL497293. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL497293 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | COc1ccc(-c2oc3c(CC=C(C)C)c(O)cc(O)c3c(=O)c2O[C@@H]2O[C@H](C)[C@@H](O)[C@H](O)[C@@H]2O)cc1 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 0c402001 01200018 200a0108 05010302 803d124d 82804920 03042801 40802600 022e4110 41980860 48000091 41008010 40808412 02a00088 11200021 102ab208 00864020 22108840 1f48a200 00825a03 00340020 0810042a 1500c000 0a584010 08400600 80004001 145a00b4 2e900068 01006300 11820a03 45e00240 02b50408 |