On Target AMPN_HUMAN 0.22857143/CHEMBL1821978
For the given ligand Sal-EOM, we have found in our database that, being scored 0.22857143, the most similar ligand is CHEMBL1821978. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL1821978 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | Cl.NC1CCc2cccc(-c3ccccc3)c2CC1=O |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 00012000 01000201 00400102 00010600 00020001 00000002 00000000 00000001 00000800 000808c0 08100000 4000b000 05008000 00200000 60000020 02080008 01020000 02001000 04002000 00000001 00000300 18000200 11004000 00400010 00800000 80000181 00000000 00000041 00004002 0006000a 00022000 00420400 |