On Target ADRB2_HUMAN 0.3372781/CHEMBL1431082
For the given ligand Sal-EOM, we have found in our database that, being scored 0.3372781, the most similar ligand is CHEMBL1431082. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL1431082 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | CCOC(=O)c1ccc(NC(=O)Cc2coc3cc4c(cc23)CCC4)cc1 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 10004002 01200800 00180102 8009c600 20000211 00004100 00000000 40200200 00024900 00080840 0c380024 40009800 41008400 00319080 40028040 120a0008 00060020 02010000 0a000008 00000001 40104100 1a220e28 20006000 81480015 08000c10 80006000 00080010 0a800090 4400a200 01060003 c0002000 00000600 |