On Target TNFA_HUMAN 0.27567568/CHEMBL3983488
For the given ligand Sal-EOM, we have found in our database that, being scored 0.27567568, the most similar ligand is CHEMBL3983488. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL3983488 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | CCCCCCCCCCCCCCO[C@@H]1[C@@H](OCCCCCCCCCCCCCC)[C@@H](OC)O[C@H](COC(=O)CCC(=O)OC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)[C@H]1OC |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 00042040 01404001 00000708 80810700 802c00c0 00220000 00002c00 01000040 00202200 01081860 08200000 4000b000 1c008000 02a00100 20041008 003a9008 08860000 02000100 1540a810 01000001 00100020 38000e10 17004010 08400018 10800400 a0041002 00808800 64200060 02004282 0006080b a0a24000 00000600 |