On Target NEP_HUMAN 0.30952382/CHEMBL4070297
For the given ligand Sal-EOM, we have found in our database that, being scored 0.30952382, the most similar ligand is CHEMBL4070297. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL4070297 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | O=C(O)[C@@H](CC(=O)C1(S)CCCCC1)Cc1ccc(-c2ccccc2)cc1 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 00052000 01000000 00000102 00110200 00080008 00000000 00000000 00000000 00a00900 00080840 08100000 40029800 04008008 00a40000 00000000 00080008 00020000 02000000 06402008 10000001 00000100 08000a00 11000140 00400010 00000800 80000000 00000000 00000040 00004002 00020002 00020000 01410400 |