On Target NOS1_HUMAN 0.18181819/CHEMBL4530822
For the given ligand Sal-EOM, we have found in our database that, being scored 0.18181819, the most similar ligand is CHEMBL4530822. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL4530822 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | CCO[C@@H]1C[C@H](CCc2cc(F)c(F)c(CCc3cc(C)cc(N)n3)c2)N(C)C1 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 0200000a 01000a00 00104102 92010700 010c02a5 00000010 00000000 20060000 00000800 000c28c0 08308004 50818000 80000802 00a89000 008a1008 020c100c 11a01200 06000080 00e02008 00300201 40000120 1c108010 37800880 00700010 00040c00 80000000 800000c0 10800001 0050020e 0086800a 00020000 20002720 |