On Target AOFB_HUMAN 0.33333334/CHEMBL1830818
For the given ligand Sal-EOM, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL1830818. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL1830818 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | CCOC(=O)c1cc2ccc(OC3CCCCCC3)cc2oc1=O |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 04000040 81208808 20080108 00010300 000c1213 02404120 02010000 40000200 02084100 40000840 00080020 40488400 40808503 00b10080 11000081 42082008 00820000 02000040 08402000 00022001 00000200 0a060a28 01200008 00580014 08000440 80006000 00080011 08901000 02002200 01020800 c0020000 00000000 |