On Target DRD3_HUMAN 0.41549295/CHEMBL3676849
For the given ligand Sal-EOM, we have found in our database that, being scored 0.41549295, the most similar ligand is CHEMBL3676849. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL3676849 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | O=C(CC1CCOCC1)N[C@H]1CC[C@H](CCN2CCC(c3coc4ccccc34)CC2)CC1 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 00010000 01201200 00180100 00014700 80080201 00000100 00004000 60200200 00024800 000808c0 0c300000 50019000 44008422 01000080 00000000 100c1008 00800020 02010000 02402000 00000201 00000120 18040618 01000000 00580018 08000400 80004000 00000010 1a800010 a0002200 0106000b 00020000 00002600 |