On Target MDR1_HUMAN 0.516129/CHEMBL1829519
For the given ligand Sal-EOM, we have found in our database that, being scored 0.516129, the most similar ligand is CHEMBL1829519. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL1829519 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | CC(=O)OC[C@]12[C@@H](OC(=O)c3ccoc3)C[C@@H]3[C@@H](OC(C)=O)[C@]1(OC3(C)C)[C@@](C)(O)C[C@H](OC(C)=O)[C@@H]2OC(C)=O |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 00000040 81200000 00080508 00010300 00280051 00000000 00010000 00200040 000a6100 01000000 040c0000 40088400 40008401 02910000 40080000 42089008 00820000 02040000 13402000 00002001 00000020 18000a00 05000000 08080014 00000400 00004000 00480410 08800020 00000200 0002000a c0020000 02000000 |