On Target P2Y12_HUMAN 0.26973686/CHEMBL420980
For the given ligand Sal-EOM, we have found in our database that, being scored 0.26973686, the most similar ligand is CHEMBL420980. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL420980 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | COC(=O)CCCCc1ccc2[nH]c3nc(O)nc-3cc2c1 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 00014002 03004810 00084102 00010300 000c0040 0000c000 00008000 00000000 00400900 00080840 08108004 40009000 04008808 00e00000 60040140 000c000c 08820000 02000004 00602000 00000001 40020100 08008a28 21800000 80400014 00000000 80000000 00028040 00000000 00400202 00420002 c0040000 0c000480 |