On Target ACE_HUMAN 0.27329192/CHEMBL284898
For the given ligand Sal-EOM, we have found in our database that, being scored 0.27329192, the most similar ligand is CHEMBL284898. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL284898 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | CCOC(=O)C(CCc1ccccc1)OC(C)C(=O)N1C(C(=O)O)CC2CCCCC21 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 00010000 01005008 00100102 80010700 00080080 00000010 00000000 20000040 00002800 000808c0 08300000 4001f200 0600801a 01a00002 80281008 38091008 10820000 82000000 02402000 00000201 00000120 18040e10 17000040 0850001c 10000400 80000000 00000000 10000021 00000200 00060003 20024000 00402600 |