On Target 5HT1B_HUMAN 0.26168224/CHEMBL82488
For the given ligand Sal-EOM, we have found in our database that, being scored 0.26168224, the most similar ligand is CHEMBL82488. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL82488 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | NC(=O)c1ccc2c(c1)CCOC2CCN1CC=C(c2coc3cc(F)ccc23)CC1 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 00000050 08208a00 00190500 42054600 00000251 00004112 80184080 60201641 00024900 00580ad8 0c300200 50008900 c0008d12 002b1080 10040002 1a0c0008 28200420 02090140 04800402 00800201 00010120 58028628 0100c080 00480034 08010401 80006201 08482010 5a810015 a0402201 01068c0a c4040000 02002600 |