On Target NTRK1_HUMAN 0.22131148/CHEMBL444109
For the given ligand Sal-EOM, we have found in our database that, being scored 0.22131148, the most similar ligand is CHEMBL444109. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL444109 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | CC(C)=CCC[C@]1(C)C=Cc2c(O)c3c(c(CC=C(C)C)c2O1)O[C@]12C(=C[C@@H]4CC1C(C)(C)O[C@@]2(C/C=C(/C)C(N)=O)C4=O)C3=O |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 04050051 81000838 22801b0b 80210702 00281041 82a20800 c22402c1 08000642 05042854 019a0a48 48140200 4000d060 1682802a 00a00000 11280407 0808b108 20800400 a2108124 1361201e 0202a801 00040120 18021680 0500a061 0a400014 01201400 c0000400 00526a08 c0800420 00414302 80274002 a4020000 00000410 |