On Target OPRX_HUMAN 0.325/CHEMBL3581762
For the given ligand Sal-EOM, we have found in our database that, being scored 0.325, the most similar ligand is CHEMBL3581762. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL3581762 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | CO[C@]12CC[C@@]3(C[C@]1(C)[C@H](O)c1ccoc1)[C@H]1Cc4ccc(O)c5c4[C@@]3(CCN1CC1CC1)[C@H]2O5 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 04001000 43200208 2018050a 00214700 00381061 c2000002 02005000 20200241 00026990 010818c0 0c380000 50818040 40804402 21b00080 11240021 520ca018 08800220 22058000 17482002 00020201 00000100 18200010 05004040 89580410 00000000 c0004001 00120610 1a800011 64000302 0007c80a 40020000 00002f40 |