On Target TRXR1_HUMAN 0.15953307/CHEMBL4281382
For the given ligand Sal-EOM, we have found in our database that, being scored 0.15953307, the most similar ligand is CHEMBL4281382. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL4281382 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | COc1cc(OC)c2c(=O)c(OCCCOc3ccccc3/C=C/C(=O)/C=C/c3ccccn3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 0c402043 40200018 28084308 10110600 0025122d 82004020 c2040080 48802608 038a4104 41100840 00000094 41008000 4080cc12 00240088 01020023 020ca20c 00064440 2a008844 1f298204 00821a02 40240001 18008e28 31a08000 02594810 09400000 82000000 144a20f4 48108248 00406304 91860a09 45401240 02240002 |