On Target PTGES_HUMAN 0.2735043/CHEMBL3289107
For the given ligand Sal-EOM, we have found in our database that, being scored 0.2735043, the most similar ligand is CHEMBL3289107. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL3289107 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | C=C(C)[C@@H]1CC[C@]2(CO)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](OC(C)=O)[C@](C)(C(=O)O)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 00010000 01000000 00000100 00010300 000c0040 00200000 00000000 00000400 00000000 01100008 00000000 40009000 14008008 00800000 00000400 00081008 00820000 00000000 03402000 00000001 00000020 00000a00 01000000 00000010 00000400 00000000 00008000 80000000 00000200 0100000a 24020000 00000000 |