On Target MIF_HUMAN 0.25882354/CHEMBL211882
For the given ligand Sal-EOM, we have found in our database that, being scored 0.25882354, the most similar ligand is CHEMBL211882. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL211882 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | CC(C)(C)COC(=O)CC1CC(c2ccc(O)c(F)c2)=NO1 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 00010040 01000008 20900102 02050b00 02080040 10440010 02000040 00002000 00108948 03092851 08110000 50009000 9400880a 00a01000 00000008 00091018 00820800 02000000 01406000 00860441 00000120 28008a00 01001042 00400010 00000400 80020004 e0120000 02000001 0010420a 00028002 40080000 00000600 |