On Target HRH1_HUMAN 0.25735295/CHEMBL1201203
For the given ligand Sal-EOM, we have found in our database that, being scored 0.25735295, the most similar ligand is CHEMBL1201203. Check out the elaboration below.
| Sal-EOM (Given Ligand) | CHEMBL1201203 (Similar Ligand) |
|---|---|
| CCOCOC4CC(C(=O)OC)C3(C)CCC2C(=O)OC(c1ccoc1)CC2(C)C3C4=O | CN1[C@H]2CC[C@@H]1C[C@H](OC(c1ccccc1)c1ccccc1)C2 |
|
|
|
|
|
|
| 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080010 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000 | 00000000 01000000 00100100 00010700 00080010 00004010 00000000 21000000 00000100 000808c0 08200000 50018000 00000002 00890000 00000000 02081008 00a00000 02000000 00c02000 00000201 00000020 18000030 01000080 00500010 00000401 a0002000 00080000 50001000 00000280 00060002 40020000 02002600 |