On Target COMT_HUMAN 0.34857142/CHEMBL4640184
For the given ligand Fentanyl, we have found in our database that, being scored 0.34857142, the most similar ligand is CHEMBL4640184. Check out the elaboration below.
| Fentanyl (Given Ligand) | CHEMBL4640184 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | C#CCCC1(CC(=O)N2CCN(Cc3cc(NC(=O)c4ccc5c(c4)CN(c4cncnc4)CC5C)cc(C(F)(F)F)c3)CC2)N=N1 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 1001401a 01022c00 40180100 54010e20 244021a1 08004010 10000400 22001808 00800180 00090dd0 08280084 4001d806 8c00888a 01302000 00400441 080e000c 30040200 02000020 08402800 80000211 40120008 38228610 22816061 8350001d 00840002 c0100000 88000400 90000080 0c528100 00460213 e0140820 00000680 |