On Target FABP5_HUMAN 0.37391305/CHEMBL4278244
For the given ligand Fentanyl, we have found in our database that, being scored 0.37391305, the most similar ligand is CHEMBL4278244. Check out the elaboration below.
| Fentanyl (Given Ligand) | CHEMBL4278244 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CC(=O)Nc1ccc2c(OC(=O)[C@H]3[C@@H](c4ccccc4)[C@H](C(=O)O)[C@@H]3c3ccccc3)cccc2c1 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 04014002 01000008 2000010a 00010700 00081000 02000000 02000000 00000000 00000800 000a0840 08380004 40009000 0480802a 02b00010 11010041 000a2008 00860000 02000000 08402008 00020401 40100100 08000e08 31002040 00400010 00000800 80000000 00000000 00000080 00008202 00060003 00000000 10000600 |