On Target NTRK1_HUMAN 0.43/CHEMBL1984131
For the given ligand Fentanyl, we have found in our database that, being scored 0.43, the most similar ligand is CHEMBL1984131. Check out the elaboration below.
| Fentanyl (Given Ligand) | CHEMBL1984131 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CCOC(=O)C(C(N)=O)C(=S)Nc1ccc(C)cc1 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00004002 00000800 00100100 00010600 20040000 00200000 00000000 20000000 00000100 00000940 00200004 50019000 18088000 04088000 00020060 00080008 00266000 02000800 08800010 00000300 60141020 18000e00 21000080 00400010 00000400 80000000 00000000 00000080 00008200 00060010 00000000 00090208 |