On Target TRXR1_HUMAN 0.25874126/CHEMBL4459518
For the given ligand Fentanyl, we have found in our database that, being scored 0.25874126, the most similar ligand is CHEMBL4459518. Check out the elaboration below.
| Fentanyl (Given Ligand) | CHEMBL4459518 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CN(CCOC(=O)/C=C/C(=O)c1ccc(F)cc1)C(C(=O)NC(C)(C)C)c1ccc(F)cc1 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00000008 00000800 00100300 86010600 00000080 00800810 02000001 02001400 01000080 00980840 48200000 4000b000 03008802 00003002 40301408 00080008 10060000 02100180 20210010 00100a00 00000100 38228e80 12008000 8340001c 00001400 c4004400 00400000 80000001 0c000300 00068003 84046000 00000610 |