On Target ACES_HUMAN 0.5113636/CHEMBL3785391
For the given ligand Primidone, we have found in our database that, being scored 0.5113636, the most similar ligand is CHEMBL3785391. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL3785391 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CN(C)C(=O)NC1CCc2cc(O)ccc2C1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00000000 43001208 20100102 00010e00 00000020 40000000 02000004 00002005 00000800 000808c0 08300000 40808000 00009002 00200000 00000000 02040008 00000208 02000000 00002000 00020201 00000100 18250400 00004000 81400018 00010000 80000001 00120000 10000000 04000002 0006000b 00080000 00000600 |