On Target PDE5A_HUMAN 0.2777778/CHEMBL336457
For the given ligand Primidone, we have found in our database that, being scored 0.2777778, the most similar ligand is CHEMBL336457. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL336457 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CCCCN1C(=O)[C@H]2Cc3c([nH]c4ccccc34)[C@H](c3ccccc3)N2C1=O |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 0001800a 0180fa00 00100100 55810e10 00041220 00180002 01002404 2300700f 00400880 000908c0 09318004 4080b000 1e009882 0060a800 000204c0 02040184 00004208 02002027 00300448 00000a01 c0020100 38278608 20804001 93400118 00153800 e0000001 08004000 d0000000 0e001184 0086000b 200c4200 a0006620 |