On Target FABP5_HUMAN 0.27586207/CHEMBL4278244
For the given ligand Primidone, we have found in our database that, being scored 0.27586207, the most similar ligand is CHEMBL4278244. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL4278244 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CC(=O)Nc1ccc2c(OC(=O)[C@H]3[C@@H](c4ccccc4)[C@H](C(=O)O)[C@@H]3c3ccccc3)cccc2c1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 04014002 01000008 2000010a 00010700 00081000 02000000 02000000 00000000 00000800 000a0840 08380004 40009000 0480802a 02b00010 11010041 000a2008 00860000 02000000 08402008 00020401 40100100 08000e08 31002040 00400010 00000800 80000000 00000000 00000080 00008202 00060003 00000000 10000600 |