On Target TRPV3_HUMAN 0.24666667/CHEMBL3664218
For the given ligand Primidone, we have found in our database that, being scored 0.24666667, the most similar ligand is CHEMBL3664218. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL3664218 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | COc1cccc(CNC(=O)CC2CC3(CCC3)Oc3ccc(Cl)cc32)c1OC1CCCC1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 04018000 45800218 2010010a 00210700 00081000 82000100 06000000 22001600 00000800 001808c0 08300000 40019840 0680c82e 01200010 91000601 020ca008 00800000 22008400 00482008 00020201 80000140 18008710 01000040 00548418 00002800 c0000000 00100000 90000000 00000302 0106c00b 24060000 00020640 |