On Target AMPN_HUMAN 0.46153846/CHEMBL1668623
For the given ligand Primidone, we have found in our database that, being scored 0.46153846, the most similar ligand is CHEMBL1668623. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL1668623 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | Cl.NC1Cc2ccccc2CC1=O |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00000000 01000200 00400102 00010600 00000020 00000000 01000000 00000001 00000800 000808c0 08100000 4080b000 05008000 00200000 40000000 02000000 00000200 02000000 00002008 00000001 00000100 18000200 00004000 81400010 00000800 80000101 00000000 00000000 04000002 0006000a 00002000 00020400 |