On Target PPARG_HUMAN 0.36585367/CHEMBL340011
For the given ligand Primidone, we have found in our database that, being scored 0.36585367, the most similar ligand is CHEMBL340011. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL340011 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CCCCCCCN(CCc1ccc(OC(C)(C)C(=O)O)cc1)C(=O)Nc1ccc(F)cc1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 04000006 01001008 20100108 02010e00 01001000 00000010 02040004 20002005 00000080 000808c0 082c0004 4001d000 00809002 00101000 01200041 00080008 00040008 82400000 08002000 00220201 40000100 18250e10 25022000 89500018 00110000 80000000 00120008 10800081 04008200 00068003 000a0000 00006600 |