On Target CHLE_HUMAN 0.42105263/CHEMBL4077192
For the given ligand Primidone, we have found in our database that, being scored 0.42105263, the most similar ligand is CHEMBL4077192. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL4077192 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | O=C(NCC1CCCN(C2Cc3ccccc3C2)C1)c1cccc2ccccc12 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00000000 01001c00 00100102 00010600 00000020 00000000 00000000 22001000 00000880 000809e0 08300000 50018000 00008802 00201000 00000400 00020000 00000200 02000000 00000000 00000201 00000100 182e8628 00004000 8150001c 00000000 c0000000 00000000 90000000 04000100 00060013 a0040000 00002600 |