On Target PDE4B_HUMAN 0.4245283/CHEMBL37119
For the given ligand Primidone, we have found in our database that, being scored 0.4245283, the most similar ligand is CHEMBL37119. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL37119 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CNC(=O)N1CCC(c2ccc(OC)c(OC3CCCC3)c2)C1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 04000000 43001208 20100108 00210f00 00081000 c2000010 02040004 00002004 00000880 000808c0 08300000 40008000 0080d002 20000080 11000001 020ca008 00800008 02000000 00480000 00020201 00000100 18250400 01000000 81400018 00010000 80000000 00120000 10000000 04000200 0106000b 00080000 00000640 |