On Target ACM4_HUMAN 0.4597701/CHEMBL2112959
For the given ligand Primidone, we have found in our database that, being scored 0.4597701, the most similar ligand is CHEMBL2112959. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL2112959 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | O=C(CCNC(=O)CC(c1ccccc1)(c1ccccc1)c1ccccc1)NCCC(=O)NC[C@H]1CCCN(CC2CCCCC2)C1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00000000 01001600 00100100 00010600 00000000 00000000 00000000 21000000 00000800 000809e0 08300000 50019000 0c008002 00000000 00000000 00040000 00000000 02000001 02002018 00000201 00000100 180c0630 00000000 00500018 00001800 a0000000 00000000 50000000 00000080 0006001b 00020000 00002600 |