On Target DRD2_HUMAN 0.47126436/CHEMBL220189
For the given ligand Primidone, we have found in our database that, being scored 0.47126436, the most similar ligand is CHEMBL220189. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL220189 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | Cc1cccc(C(=O)NCN2CCC(c3ccccc3)CC2)c1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00000000 01000a00 00100100 00010e00 00000001 00000000 10000004 22003000 00000800 000808c0 09300000 50018000 00009802 00000000 00000000 08040008 00004000 02000000 00000040 00000201 00000100 18038600 00000000 00500014 00010000 80000000 08000000 90000000 00000100 0006000b 800c0000 80000600 |