On Target NOS1_HUMAN 0.4/CHEMBL298404
For the given ligand Primidone, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL298404. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL298404 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | NC(N)=Nc1ccccc1CC(N)C(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00000002 00000000 00000100 00010e00 00000000 00000000 02002000 00000000 00000800 00080842 08100004 4000b000 04009000 40000008 000200c0 00080008 00000800 02000000 01400018 00000001 40000100 18010a00 23000040 81400010 00080800 88000000 40800000 00000800 04000000 00860002 00080000 20000500 |