On Target NK1R_HUMAN 0.48623854/CHEMBL392567
For the given ligand Primidone, we have found in our database that, being scored 0.48623854, the most similar ligand is CHEMBL392567. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL392567 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)[C@H]1CN(C(=O)N2CCCCC2)C[C@@H]1c1ccccc1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00020000 018a1600 00100100 00010e00 00000001 00000010 10000404 22003004 00200880 000809f0 08300000 50039002 0c009802 01000000 00000400 00040008 00000008 02000001 00000058 00000201 80000100 182d8600 00000000 81500018 00013800 c0000000 08000000 90000000 04000100 0006001b 201c0000 00802600 |