On Target ALDR_HUMAN 0.40869564/CHEMBL278584
For the given ligand Primidone, we have found in our database that, being scored 0.40869564, the most similar ligand is CHEMBL278584. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL278584 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CSc1ccc(Cl)cc1C1NC(=O)NC1=O |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00008001 0d803200 00120100 00112e00 00080000 08200020 04000004 02003004 00000000 00080848 09200000 6000b800 1f009804 00000000 c0000000 00040000 04004008 02002000 00000020 00000001 80020100 38218700 00800000 81480019 00002000 90000000 10008000 80000000 0c000100 00070003 20046000 80030620 |