On Target AA1R_HUMAN 0.32173914/CHEMBL2435536
For the given ligand Primidone, we have found in our database that, being scored 0.32173914, the most similar ligand is CHEMBL2435536. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL2435536 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | O=C(C(=O)c1cn(Cc2ccccc2)c2ccccc12)c1ccccc1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00008002 00801a00 00000100 40810618 00045000 00000000 00002000 00001004 04500800 000808c0 08100004 40019000 0b008820 00400800 c0000040 08040004 00000000 82800000 00200400 00000001 c0000100 18168218 20800000 8950001c 00042000 80000000 08000000 10000000 04000000 0006000a 80042200 00000520 |