On Target AOFB_HUMAN 0.5/CHEMBL299655
For the given ligand Primidone, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL299655. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL299655 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | NNC(=O)C1(c2ccccc2)CC1F |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00000004 00000000 00100100 00010600 00000000 00000020 00008000 00000000 00000800 400808c0 08100008 40009000 05008000 01200000 40000000 00000a00 00040000 02000000 00000000 00000001 80000100 18000600 40000000 81580010 00000000 80000080 00008060 10000000 04000000 040e0002 00002000 00000600 |