On Target ACM1_HUMAN 0.5316456/CHEMBL2164913
For the given ligand Primidone, we have found in our database that, being scored 0.5316456, the most similar ligand is CHEMBL2164913. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL2164913 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CC(C)N1CCN(C(=O)C(Cc2ccccc2)c2ccccc2)CC1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00000000 00002200 00100100 04010600 00000000 00000000 00000000 20000008 00000880 000808c0 08300000 40009000 05008002 00002000 40000000 00040000 00000000 02000000 00000008 00000201 00000100 38300600 00000021 83400018 00000800 80000000 00000000 10000000 0c000000 0006000b 00002000 00000700 |