On Target GRM5_HUMAN 0.42708334/CHEMBL4447269
For the given ligand Primidone, we have found in our database that, being scored 0.42708334, the most similar ligand is CHEMBL4447269. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL4447269 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CNC(=O)N1CCCC(CN2CCC(OC(c3ccccc3)c3ccccc3)CC2)C1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00000000 01001400 00100100 00010e00 00000010 00004000 00000004 21002000 00000100 000809e0 08200000 50018000 00009002 00090000 00000000 02080008 00200000 02000000 00800000 00000201 00000120 180d0420 01000080 00500018 00010401 a0002000 00080000 50000000 00000280 00060013 40180000 02002600 |