On Target P2RX3_HUMAN 0.33088234/CHEMBL3898435
For the given ligand Primidone, we have found in our database that, being scored 0.33088234, the most similar ligand is CHEMBL3898435. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL3898435 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CCC1(CC)C(=O)N/C(=N\c2ccc(OC(C)C)cc2)N(Cc2ccc(Cl)cc2)C1=O |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 04008042 01800408 20100108 00010e00 00001000 00000000 02000004 22003008 00000300 800209f2 11200004 44009820 0f809846 40000008 010004c1 00180008 00004800 02000000 01000050 00020201 c0012100 1a018700 22000010 00400018 00093000 c8000000 40440000 90000800 00000310 00860211 a00c0000 80020200 |