On Target AGTR2_HUMAN 0.37096775/CHEMBL3350599
For the given ligand Primidone, we have found in our database that, being scored 0.37096775, the most similar ligand is CHEMBL3350599. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL3350599 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CC[C@H](C)[C@H](NC(=O)[C@H](N)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(=O)O)C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00070000 01007200 00100100 04010e00 00100082 00000010 00010000 2000200c 00200880 000808c2 08300010 4003b000 0e00b012 00002009 80180000 000c0008 10000810 02000000 00c00008 00000201 00000100 38250e20 03000043 83500018 00000800 80000000 40010000 10000000 0c000002 0006000b 20084000 00802e00 |