On Target OPRM_MOUSE 0.4318182/CHEMBL596
For the given ligand Primidone, we have found in our database that, being scored 0.4318182, the most similar ligand is CHEMBL596. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL596 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CCC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 |