On Target NOS2_HUMAN 0.36363637/CHEMBL450583
For the given ligand Primidone, we have found in our database that, being scored 0.36363637, the most similar ligand is CHEMBL450583. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL450583 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | Br.CCC(NC(C)=N)c1ccccc1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00000000 00000000 00100100 00010600 00000000 00000000 00000000 02001000 00000a00 00080853 08300000 40008000 00000802 00000000 00000400 00100000 00000000 02000000 00000000 00000201 00000100 18008000 00000000 00400010 00000000 c0000000 40000000 90000000 00000110 00060002 00040008 00000600 |