On Target AA2AR_HUMAN 0.30769232/CHEMBL184517
For the given ligand Primidone, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL184517. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL184517 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | COc1ccc(CCNC(=N)Nc2nc(C)cc(C)n2)cc1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00000002 00000808 20100108 00050e00 01001004 00004000 02042004 00002000 00000300 00080842 08200025 40108800 00001002 00100000 01020001 001c000c 00008008 02004000 00400000 00a20000 00000100 1c212000 20800840 81400110 00010010 81010100 40120000 00000000 0400021c 00460802 40000000 000006a0 |